C22H20FNO4 — CID 3221325
N-[(2-fluorophenyl)methyl]-2-oxo-N-(oxolan-2-ylmethyl)chromene-3-carboxamide (PubChem CID 3221325) has the molecular formula C22H20FNO4 and a molecular weight of 381.40 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2-oxo-N-(oxolan-2-ylmethyl)chromene-3-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2-oxo-N-(oxolan-2-ylmethyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 3221325 |
| Molecular Formula | C22H20FNO4 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2-oxo-N-(oxolan-2-ylmethyl)chromene-3-carboxamide |
| SMILES | O=C(c1cc2ccccc2oc1=O)N(Cc1ccccc1F)CC1CCCO1 |
| InChI | InChI=1S/C22H20FNO4/c23-19-9-3-1-7-16(19)13-24(14-17-8-5-11-27-17)21(25)18-12-15-6-2-4-10-20(15)28-22(18)26/h1-4,6-7,9-10,12,17H,5,8,11,13-14H2 |
| InChIKey | WMADYIRUEMSKSF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|