C24H25NO6 — CID 1433078
N-[(2,3-dimethoxyphenyl)methyl]-2-oxo-N-[[(2S)-oxolan-2-yl]methyl]chromene-3-carboxamide (PubChem CID 1433078) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-2-oxo-N-[[(2S)-oxolan-2-yl]methyl]chromene-3-carboxamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-2-oxo-N-[[(2S)-oxolan-2-yl]methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 1433078 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-2-oxo-N-[[(2S)-oxolan-2-yl]methyl]chromene-3-carboxamide |
| SMILES | COc1cccc(CN(C[C@@H]2CCCO2)C(=O)c2cc3ccccc3oc2=O)c1OC |
| InChI | InChI=1S/C24H25NO6/c1-28-21-11-5-8-17(22(21)29-2)14-25(15-18-9-6-12-30-18)23(26)19-13-16-7-3-4-10-20(16)31-24(19)27/h3-5,7-8,10-11,13,18H,6,9,12,14-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | FRRJQAQQXHECLT-SFHVURJKSA-N |
| XLogP | 3.63 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|