C26H27NO6 — CID 24678704
N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-2-oxo-N-(oxolan-2-ylmethyl)chromene-3-carboxamide (PubChem CID 24678704) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-2-oxo-N-(oxolan-2-ylmethyl)chromene-3-carboxamide.
| Compound Name | N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-2-oxo-N-(oxolan-2-ylmethyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 24678704 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-2-oxo-N-(oxolan-2-ylmethyl)chromene-3-carboxamide |
| SMILES | C=CCOc1ccc(CN(CC2CCCO2)C(=O)c2cc3ccccc3oc2=O)cc1OC |
| InChI | InChI=1S/C26H27NO6/c1-3-12-32-23-11-10-18(14-24(23)30-2)16-27(17-20-8-6-13-31-20)25(28)21-15-19-7-4-5-9-22(19)33-26(21)29/h3-5,7,9-11,14-15,20H,1,6,8,12-13,16-17H2,2H3 |
| InChIKey | BTRBEKTZHZXLNU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|