C23H26BrNO5 — CID 40986327
5-bromo-2-hydroxy-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 40986327) has the molecular formula C23H26BrNO5 and a molecular weight of 476.37 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 5-bromo-2-hydroxy-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 40986327 |
| Molecular Formula | C23H26BrNO5 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 5-bromo-2-hydroxy-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | C=CCOc1ccc(CN(C[C@H]2CCCO2)C(=O)c2cc(Br)ccc2O)cc1OC |
| InChI | InChI=1S/C23H26BrNO5/c1-3-10-30-21-9-6-16(12-22(21)28-2)14-25(15-18-5-4-11-29-18)23(27)19-13-17(24)7-8-20(19)26/h3,6-9,12-13,18,26H,1,4-5,10-11,14-15H2,2H3/t18-/m1/s1 |
| InChIKey | XZZCNNPDZQVGIK-GOSISDBHSA-N |
| XLogP | 4.55 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|