C25H31NO6 — CID 24678698
3,4-dimethoxy-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 24678698) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3,4-dimethoxy-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 24678698 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 3,4-dimethoxy-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | C=CCOc1ccc(CN(CC2CCCO2)C(=O)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C25H31NO6/c1-5-12-32-22-10-8-18(14-23(22)29-3)16-26(17-20-7-6-13-31-20)25(27)19-9-11-21(28-2)24(15-19)30-4/h5,8-11,14-15,20H,1,6-7,12-13,16-17H2,2-4H3 |
| InChIKey | QNCYUAJIGHRCJV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|