C25H32N2O5S — CID 24678740
N-[4-[(3-methoxy-4-prop-2-enoxyphenyl)methyl-(oxolan-2-ylmethyl)amino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 24678740) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-[4-[(3-methoxy-4-prop-2-enoxyphenyl)methyl-(oxolan-2-ylmethyl)amino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[(3-methoxy-4-prop-2-enoxyphenyl)methyl-(oxolan-2-ylmethyl)amino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 24678740 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-[4-[(3-methoxy-4-prop-2-enoxyphenyl)methyl-(oxolan-2-ylmethyl)amino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | C=CCOc1ccc(CN(CC2CCCO2)C(=O)CCCNC(=O)c2ccsc2)cc1OC |
| InChI | InChI=1S/C25H32N2O5S/c1-3-12-32-22-9-8-19(15-23(22)30-2)16-27(17-21-6-5-13-31-21)24(28)7-4-11-26-25(29)20-10-14-33-18-20/h3,8-10,14-15,18,21H,1,4-7,11-13,16-17H2,2H3,(H,26,29) |
| InChIKey | AOCLWASYRWZEIS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|