C16H21NO4 — CID 18160322
3-methoxy-N-(oxolan-2-ylmethyl)-4-prop-2-enoxybenzamide (PubChem CID 18160322) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-methoxy-N-(oxolan-2-ylmethyl)-4-prop-2-enoxybenzamide.
| Compound Name | 3-methoxy-N-(oxolan-2-ylmethyl)-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 18160322 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3-methoxy-N-(oxolan-2-ylmethyl)-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NCC2CCCO2)cc1OC |
| InChI | InChI=1S/C16H21NO4/c1-3-8-21-14-7-6-12(10-15(14)19-2)16(18)17-11-13-5-4-9-20-13/h3,6-7,10,13H,1,4-5,8-9,11H2,2H3,(H,17,18) |
| InChIKey | MKXNGDAPFHWSHU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|