C20H21IN2O4 — CID 17205639
3-iodo-4-methoxy-N-[4-(oxolan-2-ylmethylcarbamoyl)phenyl]benzamide (PubChem CID 17205639) has the molecular formula C20H21IN2O4 and a molecular weight of 480.30 g/mol. Its IUPAC name is 3-iodo-4-methoxy-N-[4-(oxolan-2-ylmethylcarbamoyl)phenyl]benzamide.
| Compound Name | 3-iodo-4-methoxy-N-[4-(oxolan-2-ylmethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17205639 |
| Molecular Formula | C20H21IN2O4 |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 3-iodo-4-methoxy-N-[4-(oxolan-2-ylmethylcarbamoyl)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C(=O)NCC3CCCO3)cc2)cc1I |
| InChI | InChI=1S/C20H21IN2O4/c1-26-18-9-6-14(11-17(18)21)20(25)23-15-7-4-13(5-8-15)19(24)22-12-16-3-2-10-27-16/h4-9,11,16H,2-3,10,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | GTYRKNNOETWBIF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|