C24H29NO6S — CID 24678725
N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-3-methylsulfonyl-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 24678725) has the molecular formula C24H29NO6S and a molecular weight of 459.56 g/mol. Its IUPAC name is N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-3-methylsulfonyl-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-3-methylsulfonyl-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 24678725 |
| Molecular Formula | C24H29NO6S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-3-methylsulfonyl-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | C=CCOc1ccc(CN(CC2CCCO2)C(=O)c2cccc(S(C)(=O)=O)c2)cc1OC |
| InChI | InChI=1S/C24H29NO6S/c1-4-12-31-22-11-10-18(14-23(22)29-2)16-25(17-20-8-6-13-30-20)24(26)19-7-5-9-21(15-19)32(3,27)28/h4-5,7,9-11,14-15,20H,1,6,8,12-13,16-17H2,2-3H3 |
| InChIKey | FMSXZHLADUWVPR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|