C23H28FNO6S — CID 93301820
[5-[[(3-fluorobenzoyl)-[[(2R)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenyl] propane-2-sulfonate (PubChem CID 93301820) has the molecular formula C23H28FNO6S and a molecular weight of 465.54 g/mol. Its IUPAC name is [5-[[(3-fluorobenzoyl)-[[(2R)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenyl] propane-2-sulfonate.
| Compound Name | [5-[[(3-fluorobenzoyl)-[[(2R)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenyl] propane-2-sulfonate |
|---|---|
| PubChem CID | 93301820 |
| Molecular Formula | C23H28FNO6S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | [5-[[(3-fluorobenzoyl)-[[(2R)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenyl] propane-2-sulfonate |
| SMILES | COc1ccc(CN(C[C@H]2CCCO2)C(=O)c2cccc(F)c2)cc1OS(=O)(=O)C(C)C |
| InChI | InChI=1S/C23H28FNO6S/c1-16(2)32(27,28)31-22-12-17(9-10-21(22)29-3)14-25(15-20-8-5-11-30-20)23(26)18-6-4-7-19(24)13-18/h4,6-7,9-10,12-13,16,20H,5,8,11,14-15H2,1-3H3/t20-/m1/s1 |
| InChIKey | OVXRFULFQLVXSG-HXUWFJFHSA-N |
| XLogP | 3.77 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|