C22H27FN2O5S — CID 47088062
N-[(3-fluorophenyl)methyl]-4-(2-methoxyethylsulfamoyl)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 47088062) has the molecular formula C22H27FN2O5S and a molecular weight of 450.53 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-4-(2-methoxyethylsulfamoyl)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-4-(2-methoxyethylsulfamoyl)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 47088062 |
| Molecular Formula | C22H27FN2O5S |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-4-(2-methoxyethylsulfamoyl)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)N(Cc2cccc(F)c2)CC2CCCO2)cc1 |
| InChI | InChI=1S/C22H27FN2O5S/c1-29-13-11-24-31(27,28)21-9-7-18(8-10-21)22(26)25(16-20-6-3-12-30-20)15-17-4-2-5-19(23)14-17/h2,4-5,7-10,14,20,24H,3,6,11-13,15-16H2,1H3 |
| InChIKey | XFHYFQZHBWCPNM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|