C20H26FNO2 — CID 97011423
2-cyclohexylidene-N-[(3-fluorophenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 97011423) has the molecular formula C20H26FNO2 and a molecular weight of 331.43 g/mol. Its IUPAC name is 2-cyclohexylidene-N-[(3-fluorophenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-cyclohexylidene-N-[(3-fluorophenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 97011423 |
| Molecular Formula | C20H26FNO2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-cyclohexylidene-N-[(3-fluorophenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | O=C(C=C1CCCCC1)N(Cc1cccc(F)c1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C20H26FNO2/c21-18-9-4-8-17(12-18)14-22(15-19-10-5-11-24-19)20(23)13-16-6-2-1-3-7-16/h4,8-9,12-13,19H,1-3,5-7,10-11,14-15H2/t19-/m1/s1 |
| InChIKey | YKKXUDHDORHXLD-LJQANCHMSA-N |
| XLogP | 4.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|