C15H20FNO2S — CID 94348968
N-[(3-fluorophenyl)methyl]-2-methylsulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 94348968) has the molecular formula C15H20FNO2S and a molecular weight of 297.39 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-2-methylsulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-2-methylsulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 94348968 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-2-methylsulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | CSCC(=O)N(Cc1cccc(F)c1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H20FNO2S/c1-20-11-15(18)17(10-14-6-3-7-19-14)9-12-4-2-5-13(16)8-12/h2,4-5,8,14H,3,6-7,9-11H2,1H3/t14-/m0/s1 |
| InChIKey | IKYGGWBUAOUGAL-AWEZNQCLSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |