C24H25FN2O2 — CID 47087966
N-[(3-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)-2-(4-pyrrol-1-ylphenyl)acetamide (PubChem CID 47087966) has the molecular formula C24H25FN2O2 and a molecular weight of 392.47 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)-2-(4-pyrrol-1-ylphenyl)acetamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)-2-(4-pyrrol-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 47087966 |
| Molecular Formula | C24H25FN2O2 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)-2-(4-pyrrol-1-ylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-n2cccc2)cc1)N(Cc1cccc(F)c1)CC1CCCO1 |
| InChI | InChI=1S/C24H25FN2O2/c25-21-6-3-5-20(15-21)17-27(18-23-7-4-14-29-23)24(28)16-19-8-10-22(11-9-19)26-12-1-2-13-26/h1-3,5-6,8-13,15,23H,4,7,14,16-18H2 |
| InChIKey | MFYFURMNPLMDQO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |