C18H22FN3O2 — CID 94364637
(2S)-N-[(3-fluorophenyl)methyl]-2-imidazol-1-yl-N-[[(2R)-oxolan-2-yl]methyl]propanamide (PubChem CID 94364637) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is (2S)-N-[(3-fluorophenyl)methyl]-2-imidazol-1-yl-N-[[(2R)-oxolan-2-yl]methyl]propanamide.
| Compound Name | (2S)-N-[(3-fluorophenyl)methyl]-2-imidazol-1-yl-N-[[(2R)-oxolan-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 94364637 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (2S)-N-[(3-fluorophenyl)methyl]-2-imidazol-1-yl-N-[[(2R)-oxolan-2-yl]methyl]propanamide |
| SMILES | C[C@@H](C(=O)N(Cc1cccc(F)c1)C[C@H]1CCCO1)n1ccnc1 |
| InChI | InChI=1S/C18H22FN3O2/c1-14(21-8-7-20-13-21)18(23)22(12-17-6-3-9-24-17)11-15-4-2-5-16(19)10-15/h2,4-5,7-8,10,13-14,17H,3,6,9,11-12H2,1H3/t14-,17+/m0/s1 |
| InChIKey | HLNVAUGMYSGUKU-WMLDXEAASA-N |
| XLogP | 2.79 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |