C18H16Cl2F2N2O2 — CID 99804168
2,6-dichloro-5-fluoro-N-[(3-fluorophenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]pyridine-3-carboxamide (PubChem CID 99804168) has the molecular formula C18H16Cl2F2N2O2 and a molecular weight of 401.24 g/mol. Its IUPAC name is 2,6-dichloro-5-fluoro-N-[(3-fluorophenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-5-fluoro-N-[(3-fluorophenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 99804168 |
| Molecular Formula | C18H16Cl2F2N2O2 |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 2,6-dichloro-5-fluoro-N-[(3-fluorophenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(c1cc(F)c(Cl)nc1Cl)N(Cc1cccc(F)c1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C18H16Cl2F2N2O2/c19-16-14(8-15(22)17(20)23-16)18(25)24(10-13-5-2-6-26-13)9-11-3-1-4-12(21)7-11/h1,3-4,7-8,13H,2,5-6,9-10H2/t13-/m1/s1 |
| InChIKey | GGOUBRXWAKUMLP-CYBMUJFWSA-N |
| XLogP | 4.49 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|