C22H35NO6S — CID 93301936
[5-[[3,3-dimethylbutanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenyl] propane-2-sulfonate (PubChem CID 93301936) has the molecular formula C22H35NO6S and a molecular weight of 441.59 g/mol. Its IUPAC name is [5-[[3,3-dimethylbutanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenyl] propane-2-sulfonate.
| Compound Name | [5-[[3,3-dimethylbutanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenyl] propane-2-sulfonate |
|---|---|
| PubChem CID | 93301936 |
| Molecular Formula | C22H35NO6S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [5-[[3,3-dimethylbutanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenyl] propane-2-sulfonate |
| SMILES | COc1ccc(CN(C[C@H]2CCCO2)C(=O)CC(C)(C)C)cc1OS(=O)(=O)C(C)C |
| InChI | InChI=1S/C22H35NO6S/c1-16(2)30(25,26)29-20-12-17(9-10-19(20)27-6)14-23(15-18-8-7-11-28-18)21(24)13-22(3,4)5/h9-10,12,16,18H,7-8,11,13-15H2,1-6H3/t18-/m1/s1 |
| InChIKey | LRFBJFIZKDNSFX-GOSISDBHSA-N |
| XLogP | 3.76 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|