C19H31NO5S — CID 7262238
[5-[[[(2S)-butan-2-yl]-(3,3-dimethylbutanoyl)amino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 7262238) has the molecular formula C19H31NO5S and a molecular weight of 385.53 g/mol. Its IUPAC name is [5-[[[(2S)-butan-2-yl]-(3,3-dimethylbutanoyl)amino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[[(2S)-butan-2-yl]-(3,3-dimethylbutanoyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 7262238 |
| Molecular Formula | C19H31NO5S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [5-[[[(2S)-butan-2-yl]-(3,3-dimethylbutanoyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | CC[C@H](C)N(Cc1ccc(OC)c(OS(C)(=O)=O)c1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C19H31NO5S/c1-8-14(2)20(18(21)12-19(3,4)5)13-15-9-10-16(24-6)17(11-15)25-26(7,22)23/h9-11,14H,8,12-13H2,1-7H3/t14-/m0/s1 |
| InChIKey | KOBRELHFSSDGIB-AWEZNQCLSA-N |
| XLogP | 3.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|