C20H24FNO5S — CID 3531057
[5-[[[2-(4-fluorophenyl)acetyl]-propan-2-ylamino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 3531057) has the molecular formula C20H24FNO5S and a molecular weight of 409.48 g/mol. Its IUPAC name is [5-[[[2-(4-fluorophenyl)acetyl]-propan-2-ylamino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[[2-(4-fluorophenyl)acetyl]-propan-2-ylamino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 3531057 |
| Molecular Formula | C20H24FNO5S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | [5-[[[2-(4-fluorophenyl)acetyl]-propan-2-ylamino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COc1ccc(CN(C(=O)Cc2ccc(F)cc2)C(C)C)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C20H24FNO5S/c1-14(2)22(20(23)12-15-5-8-17(21)9-6-15)13-16-7-10-18(26-3)19(11-16)27-28(4,24)25/h5-11,14H,12-13H2,1-4H3 |
| InChIKey | AFVCMQRRUFFPIV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|