C21H28N2O7S — CID 3931650
[5-[[(3,5-dimethoxyphenyl)carbamoyl-propan-2-ylamino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 3931650) has the molecular formula C21H28N2O7S and a molecular weight of 452.53 g/mol. Its IUPAC name is [5-[[(3,5-dimethoxyphenyl)carbamoyl-propan-2-ylamino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[(3,5-dimethoxyphenyl)carbamoyl-propan-2-ylamino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 3931650 |
| Molecular Formula | C21H28N2O7S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [5-[[(3,5-dimethoxyphenyl)carbamoyl-propan-2-ylamino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COc1cc(NC(=O)N(Cc2ccc(OC)c(OS(C)(=O)=O)c2)C(C)C)cc(OC)c1 |
| InChI | InChI=1S/C21H28N2O7S/c1-14(2)23(21(24)22-16-10-17(27-3)12-18(11-16)28-4)13-15-7-8-19(29-5)20(9-15)30-31(6,25)26/h7-12,14H,13H2,1-6H3,(H,22,24) |
| InChIKey | HBSUKTMKCLMWCB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|