C23H32N2O7S — CID 4615518
[5-[[butan-2-yl-[(2,4-dimethoxyphenyl)carbamoyl]amino]methyl]-2-methoxyphenyl] ethanesulfonate (PubChem CID 4615518) has the molecular formula C23H32N2O7S and a molecular weight of 480.58 g/mol. Its IUPAC name is [5-[[butan-2-yl-[(2,4-dimethoxyphenyl)carbamoyl]amino]methyl]-2-methoxyphenyl] ethanesulfonate.
| Compound Name | [5-[[butan-2-yl-[(2,4-dimethoxyphenyl)carbamoyl]amino]methyl]-2-methoxyphenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4615518 |
| Molecular Formula | C23H32N2O7S |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | [5-[[butan-2-yl-[(2,4-dimethoxyphenyl)carbamoyl]amino]methyl]-2-methoxyphenyl] ethanesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OC)c(OS(=O)(=O)CC)c1)C(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C23H32N2O7S/c1-7-16(3)25(23(26)24-19-11-10-18(29-4)14-21(19)31-6)15-17-9-12-20(30-5)22(13-17)32-33(27,28)8-2/h9-14,16H,7-8,15H2,1-6H3,(H,24,26) |
| InChIKey | WZAUGQWHTVHALM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|