C20H33NO5S — CID 4259556
[5-[[butan-2-yl(hexanoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate (PubChem CID 4259556) has the molecular formula C20H33NO5S and a molecular weight of 399.55 g/mol. Its IUPAC name is [5-[[butan-2-yl(hexanoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate.
| Compound Name | [5-[[butan-2-yl(hexanoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4259556 |
| Molecular Formula | C20H33NO5S |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | [5-[[butan-2-yl(hexanoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate |
| SMILES | CCCCCC(=O)N(Cc1ccc(OC)c(OS(=O)(=O)CC)c1)C(C)CC |
| InChI | InChI=1S/C20H33NO5S/c1-6-9-10-11-20(22)21(16(4)7-2)15-17-12-13-18(25-5)19(14-17)26-27(23,24)8-3/h12-14,16H,6-11,15H2,1-5H3 |
| InChIKey | IJZFPCCVYFUNLS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|