C26H37NO5S — CID 93110767
[5-[[[(2R)-butan-2-yl]-(4-hexylbenzoyl)amino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 93110767) has the molecular formula C26H37NO5S and a molecular weight of 475.65 g/mol. Its IUPAC name is [5-[[[(2R)-butan-2-yl]-(4-hexylbenzoyl)amino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[[(2R)-butan-2-yl]-(4-hexylbenzoyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 93110767 |
| Molecular Formula | C26H37NO5S |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | [5-[[[(2R)-butan-2-yl]-(4-hexylbenzoyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | CCCCCCc1ccc(C(=O)N(Cc2ccc(OC)c(OS(C)(=O)=O)c2)[C@H](C)CC)cc1 |
| InChI | InChI=1S/C26H37NO5S/c1-6-8-9-10-11-21-12-15-23(16-13-21)26(28)27(20(3)7-2)19-22-14-17-24(31-4)25(18-22)32-33(5,29)30/h12-18,20H,6-11,19H2,1-5H3/t20-/m1/s1 |
| InChIKey | LIINZSPGYJEPDH-HXUWFJFHSA-N |
| XLogP | 5.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|