C24H33NO4S — CID 4245616
[4-[[(4-hexylbenzoyl)-propan-2-ylamino]methyl]phenyl] methanesulfonate (PubChem CID 4245616) has the molecular formula C24H33NO4S and a molecular weight of 431.60 g/mol. Its IUPAC name is [4-[[(4-hexylbenzoyl)-propan-2-ylamino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[(4-hexylbenzoyl)-propan-2-ylamino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 4245616 |
| Molecular Formula | C24H33NO4S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | [4-[[(4-hexylbenzoyl)-propan-2-ylamino]methyl]phenyl] methanesulfonate |
| SMILES | CCCCCCc1ccc(C(=O)N(Cc2ccc(OS(C)(=O)=O)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C24H33NO4S/c1-5-6-7-8-9-20-10-14-22(15-11-20)24(26)25(19(2)3)18-21-12-16-23(17-13-21)29-30(4,27)28/h10-17,19H,5-9,18H2,1-4H3 |
| InChIKey | JWLQCAVPGZEUAF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|