C27H39NO5S — CID 92999704
[5-[[[(2S)-butan-2-yl]-(4-hexylbenzoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate (PubChem CID 92999704) has the molecular formula C27H39NO5S and a molecular weight of 489.68 g/mol. Its IUPAC name is [5-[[[(2S)-butan-2-yl]-(4-hexylbenzoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate.
| Compound Name | [5-[[[(2S)-butan-2-yl]-(4-hexylbenzoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate |
|---|---|
| PubChem CID | 92999704 |
| Molecular Formula | C27H39NO5S |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | [5-[[[(2S)-butan-2-yl]-(4-hexylbenzoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate |
| SMILES | CCCCCCc1ccc(C(=O)N(Cc2ccc(OC)c(OS(=O)(=O)CC)c2)[C@@H](C)CC)cc1 |
| InChI | InChI=1S/C27H39NO5S/c1-6-9-10-11-12-22-13-16-24(17-14-22)27(29)28(21(4)7-2)20-23-15-18-25(32-5)26(19-23)33-34(30,31)8-3/h13-19,21H,6-12,20H2,1-5H3/t21-/m0/s1 |
| InChIKey | MTIULFHVSTYGQT-NRFANRHFSA-N |
| XLogP | 5.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|