C26H37NO5S — CID 3361411
[5-[[butan-2-yl-(4-pentylbenzoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate (PubChem CID 3361411) has the molecular formula C26H37NO5S and a molecular weight of 475.65 g/mol. Its IUPAC name is [5-[[butan-2-yl-(4-pentylbenzoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate.
| Compound Name | [5-[[butan-2-yl-(4-pentylbenzoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate |
|---|---|
| PubChem CID | 3361411 |
| Molecular Formula | C26H37NO5S |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | [5-[[butan-2-yl-(4-pentylbenzoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(OC)c(OS(=O)(=O)CC)c2)C(C)CC)cc1 |
| InChI | InChI=1S/C26H37NO5S/c1-6-9-10-11-21-12-15-23(16-13-21)26(28)27(20(4)7-2)19-22-14-17-24(31-5)25(18-22)32-33(29,30)8-3/h12-18,20H,6-11,19H2,1-5H3 |
| InChIKey | IRIXKVTYSJDFSP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|