C26H25BrF3NO5S — CID 4153930
[5-[[(4-bromobenzoyl)-butan-2-ylamino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4153930) has the molecular formula C26H25BrF3NO5S and a molecular weight of 600.45 g/mol. Its IUPAC name is [5-[[(4-bromobenzoyl)-butan-2-ylamino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [5-[[(4-bromobenzoyl)-butan-2-ylamino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4153930 |
| Molecular Formula | C26H25BrF3NO5S |
| Molecular Weight | 600.45 g/mol |
| Exact Mass | 599.06 |
| IUPAC Name | [5-[[(4-bromobenzoyl)-butan-2-ylamino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OC)c(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H25BrF3NO5S/c1-4-17(2)31(25(32)19-9-11-21(27)12-10-19)16-18-8-13-23(35-3)24(14-18)36-37(33,34)22-7-5-6-20(15-22)26(28,29)30/h5-15,17H,4,16H2,1-3H3 |
| InChIKey | SUQDOPMNRRGIRW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.45 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|