C25H25BrFNO5S — CID 42664941
[5-[[(4-bromobenzoyl)-butan-2-ylamino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate (PubChem CID 42664941) has the molecular formula C25H25BrFNO5S and a molecular weight of 550.45 g/mol. Its IUPAC name is [5-[[(4-bromobenzoyl)-butan-2-ylamino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate.
| Compound Name | [5-[[(4-bromobenzoyl)-butan-2-ylamino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 42664941 |
| Molecular Formula | C25H25BrFNO5S |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | [5-[[(4-bromobenzoyl)-butan-2-ylamino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H25BrFNO5S/c1-4-17(2)28(25(29)19-6-8-20(26)9-7-19)16-18-5-14-23(32-3)24(15-18)33-34(30,31)22-12-10-21(27)11-13-22/h5-15,17H,4,16H2,1-3H3 |
| InChIKey | ONGAOQRUIYVMJS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|