C26H29FN2O6S — CID 92961143
[5-[[[(2R)-butan-2-yl]-[(3-methoxyphenyl)carbamoyl]amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate (PubChem CID 92961143) has the molecular formula C26H29FN2O6S and a molecular weight of 516.59 g/mol. Its IUPAC name is [5-[[[(2R)-butan-2-yl]-[(3-methoxyphenyl)carbamoyl]amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate.
| Compound Name | [5-[[[(2R)-butan-2-yl]-[(3-methoxyphenyl)carbamoyl]amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 92961143 |
| Molecular Formula | C26H29FN2O6S |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | [5-[[[(2R)-butan-2-yl]-[(3-methoxyphenyl)carbamoyl]amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
| SMILES | CC[C@@H](C)N(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C26H29FN2O6S/c1-5-18(2)29(26(30)28-21-7-6-8-22(16-21)33-3)17-19-9-14-24(34-4)25(15-19)35-36(31,32)23-12-10-20(27)11-13-23/h6-16,18H,5,17H2,1-4H3,(H,28,30)/t18-/m1/s1 |
| InChIKey | ITQIWBJKBAKRAN-GOSISDBHSA-N |
| XLogP | 5.44 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|