C27H30FNO7S — CID 98229766
[5-[[[(2R)-butan-2-yl]-(2,4-dimethoxybenzoyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate (PubChem CID 98229766) has the molecular formula C27H30FNO7S and a molecular weight of 531.60 g/mol. Its IUPAC name is [5-[[[(2R)-butan-2-yl]-(2,4-dimethoxybenzoyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate.
| Compound Name | [5-[[[(2R)-butan-2-yl]-(2,4-dimethoxybenzoyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 98229766 |
| Molecular Formula | C27H30FNO7S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | [5-[[[(2R)-butan-2-yl]-(2,4-dimethoxybenzoyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
| SMILES | CC[C@@H](C)N(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C27H30FNO7S/c1-6-18(2)29(27(30)23-13-10-21(33-3)16-25(23)35-5)17-19-7-14-24(34-4)26(15-19)36-37(31,32)22-11-8-20(28)9-12-22/h7-16,18H,6,17H2,1-5H3/t18-/m1/s1 |
| InChIKey | JAGJWYHWAYOYGW-GOSISDBHSA-N |
| XLogP | 5.06 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|