C27H31FN2O5S — CID 4178483
[5-[[butan-2-yl-[(3,4-dimethylphenyl)carbamoyl]amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate (PubChem CID 4178483) has the molecular formula C27H31FN2O5S and a molecular weight of 514.62 g/mol. Its IUPAC name is [5-[[butan-2-yl-[(3,4-dimethylphenyl)carbamoyl]amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate.
| Compound Name | [5-[[butan-2-yl-[(3,4-dimethylphenyl)carbamoyl]amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 4178483 |
| Molecular Formula | C27H31FN2O5S |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | [5-[[butan-2-yl-[(3,4-dimethylphenyl)carbamoyl]amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C27H31FN2O5S/c1-6-20(4)30(27(31)29-23-11-7-18(2)19(3)15-23)17-21-8-14-25(34-5)26(16-21)35-36(32,33)24-12-9-22(28)10-13-24/h7-16,20H,6,17H2,1-5H3,(H,29,31) |
| InChIKey | XQZGUPGYKVYLDR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|