C25H27FN2O5S — CID 92516060
[4-[[[(2S)-butan-2-yl]-[(3-methoxyphenyl)carbamoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 92516060) has the molecular formula C25H27FN2O5S and a molecular weight of 486.57 g/mol. Its IUPAC name is [4-[[[(2S)-butan-2-yl]-[(3-methoxyphenyl)carbamoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[[(2S)-butan-2-yl]-[(3-methoxyphenyl)carbamoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 92516060 |
| Molecular Formula | C25H27FN2O5S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | [4-[[[(2S)-butan-2-yl]-[(3-methoxyphenyl)carbamoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC[C@H](C)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C25H27FN2O5S/c1-4-18(2)28(25(29)27-21-6-5-7-23(16-21)32-3)17-19-8-12-22(13-9-19)33-34(30,31)24-14-10-20(26)11-15-24/h5-16,18H,4,17H2,1-3H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | HUCARKOZYWLUOG-SFHVURJKSA-N |
| XLogP | 5.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|