C25H27FN2O6S — CID 4088119
[3-[[(2,4-dimethoxyphenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 4088119) has the molecular formula C25H27FN2O6S and a molecular weight of 502.56 g/mol. Its IUPAC name is [3-[[(2,4-dimethoxyphenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[(2,4-dimethoxyphenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 4088119 |
| Molecular Formula | C25H27FN2O6S |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | [3-[[(2,4-dimethoxyphenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COc1ccc(NC(=O)N(Cc2cccc(OS(=O)(=O)c3ccc(F)cc3)c2)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C25H27FN2O6S/c1-17(2)28(25(29)27-23-13-10-20(32-3)15-24(23)33-4)16-18-6-5-7-21(14-18)34-35(30,31)22-11-8-19(26)9-12-22/h5-15,17H,16H2,1-4H3,(H,27,29) |
| InChIKey | DPHDBFPJAANQMM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|