C25H26FNO6S — CID 42775837
[4-[[(2,6-dimethoxybenzoyl)-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 42775837) has the molecular formula C25H26FNO6S and a molecular weight of 487.55 g/mol. Its IUPAC name is [4-[[(2,6-dimethoxybenzoyl)-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[(2,6-dimethoxybenzoyl)-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 42775837 |
| Molecular Formula | C25H26FNO6S |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | [4-[[(2,6-dimethoxybenzoyl)-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COc1cccc(OC)c1C(=O)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)C(C)C |
| InChI | InChI=1S/C25H26FNO6S/c1-17(2)27(25(28)24-22(31-3)6-5-7-23(24)32-4)16-18-8-12-20(13-9-18)33-34(29,30)21-14-10-19(26)11-15-21/h5-15,17H,16H2,1-4H3 |
| InChIKey | MIRUBPOYMTWGBI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|