C23H28FNO4S — CID 4985494
[4-[[cyclohexanecarbonyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 4985494) has the molecular formula C23H28FNO4S and a molecular weight of 433.55 g/mol. Its IUPAC name is [4-[[cyclohexanecarbonyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[cyclohexanecarbonyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 4985494 |
| Molecular Formula | C23H28FNO4S |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | [4-[[cyclohexanecarbonyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(C)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C23H28FNO4S/c1-17(2)25(23(26)19-6-4-3-5-7-19)16-18-8-12-21(13-9-18)29-30(27,28)22-14-10-20(24)11-15-22/h8-15,17,19H,3-7,16H2,1-2H3 |
| InChIKey | YHHDMGKIMPHJMW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|