C19H29NO4S — CID 7411990
[4-[[[(2S)-butan-2-yl]-(cyclopentanecarbonyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 7411990) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is [4-[[[(2S)-butan-2-yl]-(cyclopentanecarbonyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[[(2S)-butan-2-yl]-(cyclopentanecarbonyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 7411990 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [4-[[[(2S)-butan-2-yl]-(cyclopentanecarbonyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CC[C@H](C)N(Cc1ccc(OS(=O)(=O)CC)cc1)C(=O)C1CCCC1 |
| InChI | InChI=1S/C19H29NO4S/c1-4-15(3)20(19(21)17-8-6-7-9-17)14-16-10-12-18(13-11-16)24-25(22,23)5-2/h10-13,15,17H,4-9,14H2,1-3H3/t15-/m0/s1 |
| InChIKey | NYTOSOBWVQALHT-HNNXBMFYSA-N |
| XLogP | 3.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|