C21H27NO4S — CID 3282352
[4-[[butan-2-yl-(2-methylbenzoyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 3282352) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is [4-[[butan-2-yl-(2-methylbenzoyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[butan-2-yl-(2-methylbenzoyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 3282352 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [4-[[butan-2-yl-(2-methylbenzoyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OS(=O)(=O)CC)cc1)C(=O)c1ccccc1C |
| InChI | InChI=1S/C21H27NO4S/c1-5-17(4)22(21(23)20-10-8-7-9-16(20)3)15-18-11-13-19(14-12-18)26-27(24,25)6-2/h7-14,17H,5-6,15H2,1-4H3 |
| InChIKey | PQWBREOHUTYVPL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|