C17H27NO4S — CID 7419070
[4-[[butanoyl-[(2R)-butan-2-yl]amino]methyl]phenyl] ethanesulfonate (PubChem CID 7419070) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is [4-[[butanoyl-[(2R)-butan-2-yl]amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[butanoyl-[(2R)-butan-2-yl]amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 7419070 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [4-[[butanoyl-[(2R)-butan-2-yl]amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCCC(=O)N(Cc1ccc(OS(=O)(=O)CC)cc1)[C@H](C)CC |
| InChI | InChI=1S/C17H27NO4S/c1-5-8-17(19)18(14(4)6-2)13-15-9-11-16(12-10-15)22-23(20,21)7-3/h9-12,14H,5-8,13H2,1-4H3/t14-/m1/s1 |
| InChIKey | RMWVXQWBFMDISO-CQSZACIVSA-N |
| XLogP | 3.34 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|