C18H27NO6S — CID 7414276
ethyl 4-[[(2R)-butan-2-yl]-[(4-methylsulfonyloxyphenyl)methyl]amino]-4-oxobutanoate (PubChem CID 7414276) has the molecular formula C18H27NO6S and a molecular weight of 385.48 g/mol. Its IUPAC name is ethyl 4-[[(2R)-butan-2-yl]-[(4-methylsulfonyloxyphenyl)methyl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[(2R)-butan-2-yl]-[(4-methylsulfonyloxyphenyl)methyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 7414276 |
| Molecular Formula | C18H27NO6S |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | ethyl 4-[[(2R)-butan-2-yl]-[(4-methylsulfonyloxyphenyl)methyl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(Cc1ccc(OS(C)(=O)=O)cc1)[C@H](C)CC |
| InChI | InChI=1S/C18H27NO6S/c1-5-14(3)19(17(20)11-12-18(21)24-6-2)13-15-7-9-16(10-8-15)25-26(4,22)23/h7-10,14H,5-6,11-13H2,1-4H3/t14-/m1/s1 |
| InChIKey | IRIILTQYOGVGTF-CQSZACIVSA-N |
| XLogP | 2.50 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|