C17H28N2O4S — CID 7262435
[4-[[[(2R)-butan-2-yl]-(tert-butylcarbamoyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 7262435) has the molecular formula C17H28N2O4S and a molecular weight of 356.49 g/mol. Its IUPAC name is [4-[[[(2R)-butan-2-yl]-(tert-butylcarbamoyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[[(2R)-butan-2-yl]-(tert-butylcarbamoyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 7262435 |
| Molecular Formula | C17H28N2O4S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [4-[[[(2R)-butan-2-yl]-(tert-butylcarbamoyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC[C@@H](C)N(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H28N2O4S/c1-7-13(2)19(16(20)18-17(3,4)5)12-14-8-10-15(11-9-14)23-24(6,21)22/h8-11,13H,7,12H2,1-6H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | WUJBWMGZJWMSHW-CYBMUJFWSA-N |
| XLogP | 3.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|