C22H30N2O4S — CID 7238726
[4-[[[(2S)-butan-2-yl]-[(4-propan-2-ylphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate (PubChem CID 7238726) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is [4-[[[(2S)-butan-2-yl]-[(4-propan-2-ylphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[[(2S)-butan-2-yl]-[(4-propan-2-ylphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 7238726 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [4-[[[(2S)-butan-2-yl]-[(4-propan-2-ylphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate |
| SMILES | CC[C@H](C)N(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H30N2O4S/c1-6-17(4)24(15-18-7-13-21(14-8-18)28-29(5,26)27)22(25)23-20-11-9-19(10-12-20)16(2)3/h7-14,16-17H,6,15H2,1-5H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | DOMAYMOTIAYVBC-KRWDZBQOSA-N |
| XLogP | 4.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|