C21H28N2O4S — CID 7262618
[4-[[[(2R)-butan-2-yl]-[(2,4-dimethylphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate (PubChem CID 7262618) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is [4-[[[(2R)-butan-2-yl]-[(2,4-dimethylphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[[(2R)-butan-2-yl]-[(2,4-dimethylphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 7262618 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [4-[[[(2R)-butan-2-yl]-[(2,4-dimethylphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate |
| SMILES | CC[C@@H](C)N(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C21H28N2O4S/c1-6-17(4)23(21(24)22-20-12-7-15(2)13-16(20)3)14-18-8-10-19(11-9-18)27-28(5,25)26/h7-13,17H,6,14H2,1-5H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | ZFVJMJJXGABDEO-QGZVFWFLSA-N |
| XLogP | 4.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|