2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid

C15H22N2O3 — CID 61188375

IUPAC2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid
SMILESCCC(C)N(CC(=O)O)C(=O)Nc1ccc(C)cc1C
InChIInChI=1S/C15H22N2O3/c1-5-12(4)17(9-14(18)19)15(20)16-13-7-6-10(2)8-11(13)3/h6-8,12H,5,9H2,1-4H3,(H,16,20)(H,18,19)
InChIKeyCCLKWQKFCUEQAR-UHFFFAOYSA-N
MW278.35 g/mol
LogP3.02
Rot. Bonds5

About 2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid

2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid (PubChem CID 61188375) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid.

Molecular Properties

Compound Name2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid
PubChem CID61188375
Molecular FormulaC15H22N2O3
Molecular Weight278.35 g/mol
Exact Mass278.16
IUPAC Name2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid
SMILESCCC(C)N(CC(=O)O)C(=O)Nc1ccc(C)cc1C
InChIInChI=1S/C15H22N2O3/c1-5-12(4)17(9-14(18)19)15(20)16-13-7-6-10(2)8-11(13)3/h6-8,12H,5,9H2,1-4H3,(H,16,20)(H,18,19)
InChIKeyCCLKWQKFCUEQAR-UHFFFAOYSA-N
XLogP3.02
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.35
LogP ≤ 53.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid?
The IUPAC name of 2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid (CID 61188375) is 2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid.
What is the SMILES notation for 2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid?
The canonical SMILES for 2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid is CCC(C)N(CC(=O)O)C(=O)Nc1ccc(C)cc1C.
What is the InChIKey of 2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid?
The InChIKey is CCLKWQKFCUEQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-5-12(4)17(9-14(18)19)15(20)16-13-7-6-10(2)8-11(13)3/h6-8,12H,5,9H2,1-4H3,(H,16,20)(H,18,19).
What are the key properties of 2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid?
2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid has a molecular weight of 278.35 g/mol, XLogP of 3.02, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butan-2-yl-[(2,4-dimethylphenyl)carbamoyl]amino]acetic acid is sourced from PubChem (CID 61188375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).