C13H15Cl3N2O3 — CID 61181583
2-[butan-2-yl-[(2,4,5-trichlorophenyl)carbamoyl]amino]acetic acid (PubChem CID 61181583) has the molecular formula C13H15Cl3N2O3 and a molecular weight of 353.63 g/mol. Its IUPAC name is 2-[butan-2-yl-[(2,4,5-trichlorophenyl)carbamoyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[(2,4,5-trichlorophenyl)carbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 61181583 |
| Molecular Formula | C13H15Cl3N2O3 |
| Molecular Weight | 353.63 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-[butan-2-yl-[(2,4,5-trichlorophenyl)carbamoyl]amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl3N2O3/c1-3-7(2)18(6-12(19)20)13(21)17-11-5-9(15)8(14)4-10(11)16/h4-5,7H,3,6H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | DGCRYCDZYNQPNX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|