C11H11Cl3N2O3 — CID 43442478
2-[methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]acetic acid (PubChem CID 43442478) has the molecular formula C11H11Cl3N2O3 and a molecular weight of 325.58 g/mol. Its IUPAC name is 2-[methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]acetic acid.
| Compound Name | 2-[methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 43442478 |
| Molecular Formula | C11H11Cl3N2O3 |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 2-[methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)CC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl3N2O3/c1-16(5-11(18)19)4-10(17)15-9-3-7(13)6(12)2-8(9)14/h2-3H,4-5H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | JGFXZPKNTGIWDC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|