C13H13Cl3N2O3 — CID 79269937
2-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]-prop-2-enylamino]acetic acid (PubChem CID 79269937) has the molecular formula C13H13Cl3N2O3 and a molecular weight of 351.62 g/mol. Its IUPAC name is 2-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]-prop-2-enylamino]acetic acid.
| Compound Name | 2-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79269937 |
| Molecular Formula | C13H13Cl3N2O3 |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 2-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)CC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl3N2O3/c1-2-3-18(7-13(20)21)6-12(19)17-11-5-9(15)8(14)4-10(11)16/h2,4-5H,1,3,6-7H2,(H,17,19)(H,20,21) |
| InChIKey | FFELHYRPVMMYDF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|