C12H14Cl4N2O3 — CID 119913466
2-[methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]propanoic acid;hydrochloride (PubChem CID 119913466) has the molecular formula C12H14Cl4N2O3 and a molecular weight of 376.07 g/mol. Its IUPAC name is 2-[methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]propanoic acid;hydrochloride.
| Compound Name | 2-[methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119913466 |
| Molecular Formula | C12H14Cl4N2O3 |
| Molecular Weight | 376.07 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 2-[methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]propanoic acid;hydrochloride |
| SMILES | CC(C(=O)O)N(C)CC(=O)Nc1cc(Cl)c(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C12H13Cl3N2O3.ClH/c1-6(12(19)20)17(2)5-11(18)16-10-4-8(14)7(13)3-9(10)15;/h3-4,6H,5H2,1-2H3,(H,16,18)(H,19,20);1H |
| InChIKey | LLSQUCYZPVHVTI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.07 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|