C11H14Cl3N3O — CID 62688637
2-[2-aminoethyl(methyl)amino]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 62688637) has the molecular formula C11H14Cl3N3O and a molecular weight of 310.61 g/mol. Its IUPAC name is 2-[2-aminoethyl(methyl)amino]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[2-aminoethyl(methyl)amino]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 62688637 |
| Molecular Formula | C11H14Cl3N3O |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-[2-aminoethyl(methyl)amino]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CN(CCN)CC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3N3O/c1-17(3-2-15)6-11(18)16-10-5-8(13)7(12)4-9(10)14/h4-5H,2-3,6,15H2,1H3,(H,16,18) |
| InChIKey | VWHVMIRBNJQFEE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|