C20H20Cl3N3O2 — CID 34622925
N-cyclopropyl-4-[[methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]methyl]benzamide (PubChem CID 34622925) has the molecular formula C20H20Cl3N3O2 and a molecular weight of 440.76 g/mol. Its IUPAC name is N-cyclopropyl-4-[[methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]methyl]benzamide.
| Compound Name | N-cyclopropyl-4-[[methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 34622925 |
| Molecular Formula | C20H20Cl3N3O2 |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | N-cyclopropyl-4-[[methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]methyl]benzamide |
| SMILES | CN(CC(=O)Nc1cc(Cl)c(Cl)cc1Cl)Cc1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C20H20Cl3N3O2/c1-26(11-19(27)25-18-9-16(22)15(21)8-17(18)23)10-12-2-4-13(5-3-12)20(28)24-14-6-7-14/h2-5,8-9,14H,6-7,10-11H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | XYZKGHREJZBVCE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|