C15H20Cl3N3O2 — CID 8756684
2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 8756684) has the molecular formula C15H20Cl3N3O2 and a molecular weight of 380.70 g/mol. Its IUPAC name is 2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 8756684 |
| Molecular Formula | C15H20Cl3N3O2 |
| Molecular Weight | 380.70 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1cc(Cl)c(Cl)cc1Cl)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H20Cl3N3O2/c1-15(2,3)20-14(23)8-21(4)7-13(22)19-12-6-10(17)9(16)5-11(12)18/h5-6H,7-8H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | YVKZFBYQKLNIFY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|